C28H40N2O3 — CID 90046727
nonan-4-yl N-[2-[4-[4-(dimethylcarbamoyl)phenyl]phenyl]propan-2-yl]carbamate (PubChem CID 90046727) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is nonan-4-yl N-[2-[4-[4-(dimethylcarbamoyl)phenyl]phenyl]propan-2-yl]carbamate.
| Compound Name | nonan-4-yl N-[2-[4-[4-(dimethylcarbamoyl)phenyl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 90046727 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | nonan-4-yl N-[2-[4-[4-(dimethylcarbamoyl)phenyl]phenyl]propan-2-yl]carbamate |
| SMILES | CCCCCC(CCC)OC(=O)NC(C)(C)c1ccc(-c2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H40N2O3/c1-7-9-10-12-25(11-8-2)33-27(32)29-28(3,4)24-19-17-22(18-20-24)21-13-15-23(16-14-21)26(31)30(5)6/h13-20,25H,7-12H2,1-6H3,(H,29,32) |
| InChIKey | PHTMDZHKACIFFH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|