C29H32N2O5S — CID 59544827
methyl 4-[(1S)-1-[2-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propan-2-ylcarbamoyloxy]butyl]benzoate (PubChem CID 59544827) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[2-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propan-2-ylcarbamoyloxy]butyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[2-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propan-2-ylcarbamoyloxy]butyl]benzoate |
|---|---|
| PubChem CID | 59544827 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | methyl 4-[(1S)-1-[2-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propan-2-ylcarbamoyloxy]butyl]benzoate |
| SMILES | CCC[C@H](OC(=O)NC(C)(C)c1ccc(C(=O)Nc2ccccc2S)cc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C29H32N2O5S/c1-5-8-24(19-11-13-21(14-12-19)27(33)35-4)36-28(34)31-29(2,3)22-17-15-20(16-18-22)26(32)30-23-9-6-7-10-25(23)37/h6-7,9-18,24,37H,5,8H2,1-4H3,(H,30,32)(H,31,34)/t24-/m0/s1 |
| InChIKey | PTQVJKJFSNCJCL-DEOSSOPVSA-N |
| XLogP | 6.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|