C44H78N4O4 — CID 134217959
(6,8-dimethyltridecan-7-ylideneamino) N-[2-[3-[2-[(6,8-dimethyltridecan-7-ylideneamino)oxycarbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate (PubChem CID 134217959) has the molecular formula C44H78N4O4 and a molecular weight of 727.13 g/mol. Its IUPAC name is (6,8-dimethyltridecan-7-ylideneamino) N-[2-[3-[2-[(6,8-dimethyltridecan-7-ylideneamino)oxycarbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate.
| Compound Name | (6,8-dimethyltridecan-7-ylideneamino) N-[2-[3-[2-[(6,8-dimethyltridecan-7-ylideneamino)oxycarbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 134217959 |
| Molecular Formula | C44H78N4O4 |
| Molecular Weight | 727.13 g/mol |
| Exact Mass | 726.60 |
| IUPAC Name | (6,8-dimethyltridecan-7-ylideneamino) N-[2-[3-[2-[(6,8-dimethyltridecan-7-ylideneamino)oxycarbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate |
| SMILES | CCCCCC(C)C(=NOC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)ON=C(C(C)CCCCC)C(C)CCCCC)c1)C(C)CCCCC |
| InChI | InChI=1S/C44H78N4O4/c1-13-17-21-26-33(5)39(34(6)27-22-18-14-2)47-51-41(49)45-43(9,10)37-30-25-31-38(32-37)44(11,12)46-42(50)52-48-40(35(7)28-23-19-15-3)36(8)29-24-20-16-4/h25,30-36H,13-24,26-29H2,1-12H3,(H,45,49)(H,46,50) |
| InChIKey | OLBHQPWTZLETHN-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.13 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|