C46H80N2O4 — CID 166727396
(2-heptan-2-yl-3-methyloct-1-enyl) N-[2-[3-[2-[(2-heptan-2-yl-3-methyloct-1-enoxy)carbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate (PubChem CID 166727396) has the molecular formula C46H80N2O4 and a molecular weight of 725.16 g/mol. Its IUPAC name is (2-heptan-2-yl-3-methyloct-1-enyl) N-[2-[3-[2-[(2-heptan-2-yl-3-methyloct-1-enoxy)carbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate.
| Compound Name | (2-heptan-2-yl-3-methyloct-1-enyl) N-[2-[3-[2-[(2-heptan-2-yl-3-methyloct-1-enoxy)carbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 166727396 |
| Molecular Formula | C46H80N2O4 |
| Molecular Weight | 725.16 g/mol |
| Exact Mass | 724.61 |
| IUPAC Name | (2-heptan-2-yl-3-methyloct-1-enyl) N-[2-[3-[2-[(2-heptan-2-yl-3-methyloct-1-enoxy)carbonylamino]propan-2-yl]phenyl]propan-2-yl]carbamate |
| SMILES | CCCCCC(C)C(=COC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)OC=C(C(C)CCCCC)C(C)CCCCC)c1)C(C)CCCCC |
| InChI | InChI=1S/C46H80N2O4/c1-13-17-21-26-35(5)41(36(6)27-22-18-14-2)33-51-43(49)47-45(9,10)39-30-25-31-40(32-39)46(11,12)48-44(50)52-34-42(37(7)28-23-19-15-3)38(8)29-24-20-16-4/h25,30-38H,13-24,26-29H2,1-12H3,(H,47,49)(H,48,50) |
| InChIKey | NBIUYHFQZBWDEM-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.16 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|