C13H22N2O3 — CID 90046870
2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate hydroxide (PubChem CID 90046870) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate hydroxide.
| Compound Name | 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate hydroxide |
|---|---|
| PubChem CID | 90046870 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(3-butylimidazol-3-ium-1-yl)ethyl 2-methylprop-2-enoate hydroxide |
| SMILES | C=C(C)C(=O)OCCn1cc[n+](CCCC)c1.[OH-] |
| InChI | InChI=1S/C13H21N2O2.H2O/c1-4-5-6-14-7-8-15(11-14)9-10-17-13(16)12(2)3;/h7-8,11H,2,4-6,9-10H2,1,3H3;1H2/q+1;/p-1 |
| InChIKey | NGLGYDBALBUOAZ-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|