C15H17BN6O2 — CID 144847445
2-(3-ethylimidazol-1-ium-1-yl)ethyl 2-methylprop-2-enoate;tetracyanoboranuide (PubChem CID 144847445) has the molecular formula C15H17BN6O2 and a molecular weight of 324.15 g/mol. Its IUPAC name is 2-(3-ethylimidazol-1-ium-1-yl)ethyl 2-methylprop-2-enoate;tetracyanoboranuide.
| Compound Name | 2-(3-ethylimidazol-1-ium-1-yl)ethyl 2-methylprop-2-enoate;tetracyanoboranuide |
|---|---|
| PubChem CID | 144847445 |
| Molecular Formula | C15H17BN6O2 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(3-ethylimidazol-1-ium-1-yl)ethyl 2-methylprop-2-enoate;tetracyanoboranuide |
| SMILES | C=C(C)C(=O)OCC[n+]1ccn(CC)c1.N#C[B-](C#N)(C#N)C#N |
| InChI | InChI=1S/C11H17N2O2.C4BN4/c1-4-12-5-6-13(9-12)7-8-15-11(14)10(2)3;6-1-5(2-7,3-8)4-9/h5-6,9H,2,4,7-8H2,1,3H3;/q+1;-1 |
| InChIKey | XNBVDWZHRCZSSN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 130.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|