C23H33N2O8+ — CID 159918229
2-[3-[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]imidazol-3-ium-1-yl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 159918229) has the molecular formula C23H33N2O8+ and a molecular weight of 465.52 g/mol. Its IUPAC name is 2-[3-[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]imidazol-3-ium-1-yl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | 2-[3-[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]imidazol-3-ium-1-yl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 159918229 |
| Molecular Formula | C23H33N2O8+ |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-[3-[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]imidazol-3-ium-1-yl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OCCn1cc[n+](CCOC(=O)CCCOC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C23H33N2O8/c1-18(2)22(28)32-13-5-7-20(26)30-15-11-24-9-10-25(17-24)12-16-31-21(27)8-6-14-33-23(29)19(3)4/h9-10,17H,1,3,5-8,11-16H2,2,4H3/q+1 |
| InChIKey | VJWXFMVYNOVEMN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|