C13H23N2O5S+ — CID 175840300
1-ethyl-3-methylimidazol-3-ium;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid (PubChem CID 175840300) has the molecular formula C13H23N2O5S+ and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid.
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175840300 |
| Molecular Formula | C13H23N2O5S+ |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)O.CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C7H12O5S.C6H11N2/c1-6(2)7(8)12-4-3-5-13(9,10)11;1-3-8-5-4-7(2)6-8/h1,3-5H2,2H3,(H,9,10,11);4-6H,3H2,1-2H3/q;+1 |
| InChIKey | QBCGAMZAHIQXBA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|