C15H21F6N3O5S2+2 — CID 90074145
[1-[2-(3-butylimidazol-3-ium-1-yl)ethoxy]-2-methylprop-2-enylidene]-bis(trifluoromethylsulfonyl)azanium (PubChem CID 90074145) has the molecular formula C15H21F6N3O5S2+2 and a molecular weight of 501.47 g/mol. Its IUPAC name is [1-[2-(3-butylimidazol-3-ium-1-yl)ethoxy]-2-methylprop-2-enylidene]-bis(trifluoromethylsulfonyl)azanium.
| Compound Name | [1-[2-(3-butylimidazol-3-ium-1-yl)ethoxy]-2-methylprop-2-enylidene]-bis(trifluoromethylsulfonyl)azanium |
|---|---|
| PubChem CID | 90074145 |
| Molecular Formula | C15H21F6N3O5S2+2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | [1-[2-(3-butylimidazol-3-ium-1-yl)ethoxy]-2-methylprop-2-enylidene]-bis(trifluoromethylsulfonyl)azanium |
| SMILES | C=C(C)C(OCCn1cc[n+](CCCC)c1)=[N+](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H21F6N3O5S2/c1-4-5-6-22-7-8-23(11-22)9-10-29-13(12(2)3)24(30(25,26)14(16,17)18)31(27,28)15(19,20)21/h7-8,11H,2,4-6,9-10H2,1,3H3/q+2 |
| InChIKey | IHVCQNDTFATDCU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|