C35H39F2N5O4 — CID 90048401
1-N'-[4-[7-[5-(diethylamino)pentyl]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 90048401) has the molecular formula C35H39F2N5O4 and a molecular weight of 631.72 g/mol. Its IUPAC name is 1-N'-[4-[7-[5-(diethylamino)pentyl]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-[5-(diethylamino)pentyl]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90048401 |
| Molecular Formula | C35H39F2N5O4 |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | 1-N'-[4-[7-[5-(diethylamino)pentyl]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCN(CC)CCCCCc1cc2ncnc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C35H39F2N5O4/c1-4-42(5-2)18-8-6-7-9-23-19-29-27(21-31(23)45-3)32(39-22-38-29)46-30-15-14-26(20-28(30)37)41-34(44)35(16-17-35)33(43)40-25-12-10-24(36)11-13-25/h10-15,19-22H,4-9,16-18H2,1-3H3,(H,40,43)(H,41,44) |
| InChIKey | YOSGICOORWXXBG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|