C19H17F2N5O4 — CID 90051192
2-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,5,7-tetraen-3-yl]acetaldehyde (PubChem CID 90051192) has the molecular formula C19H17F2N5O4 and a molecular weight of 417.37 g/mol. Its IUPAC name is 2-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,5,7-tetraen-3-yl]acetaldehyde.
| Compound Name | 2-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,5,7-tetraen-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 90051192 |
| Molecular Formula | C19H17F2N5O4 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,5,7-tetraen-3-yl]acetaldehyde |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4n[nH]c(CC=O)c4c3N(C)C2=O)c1F |
| InChI | InChI=1S/C19H17F2N5O4/c1-25-16-9(7-22-18-13(16)10(4-5-27)23-24-18)8-26(19(25)28)17-14(20)11(29-2)6-12(30-3)15(17)21/h5-7H,4,8H2,1-3H3,(H,22,23,24) |
| InChIKey | IKZGZMBKOYAJIX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|