About 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate
2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate (PubChem CID 90051313) has the molecular formula C12H15NO4S2
and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate.
Molecular Properties
| Compound Name | 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate |
| PubChem CID | 90051313 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate |
| SMILES | C=CC(=O)OCCSSCCOC(=O)n1cccc1 |
| InChI | InChI=1S/C12H15NO4S2/c1-2-11(14)16-7-9-18-19-10-8-17-12(15)13-5-3-4-6-13/h2-6H,1,7-10H2 |
| InChIKey | DQIWFEIWHFEWJB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate?
The IUPAC name of 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate (CID 90051313) is 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate.
What is the SMILES notation for 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate?
The canonical SMILES for 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate is C=CC(=O)OCCSSCCOC(=O)n1cccc1.
What is the InChIKey of 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate?
The InChIKey is DQIWFEIWHFEWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4S2/c1-2-11(14)16-7-9-18-19-10-8-17-12(15)13-5-3-4-6-13/h2-6H,1,7-10H2.
What are the key properties of 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate?
2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate has a molecular weight of 301.39 g/mol, XLogP of 2.58, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-prop-2-enoyloxyethyldisulfanyl)ethyl pyrrole-1-carboxylate is sourced from PubChem (CID 90051313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).