C24H28ClN3OS — CID 90056627
4-(4-benzylpiperazin-1-yl)-2-[6-(methylamino)-1-benzothiophen-3-yl]but-1-en-1-one;hydrochloride (PubChem CID 90056627) has the molecular formula C24H28ClN3OS and a molecular weight of 442.03 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-2-[6-(methylamino)-1-benzothiophen-3-yl]but-1-en-1-one;hydrochloride.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-2-[6-(methylamino)-1-benzothiophen-3-yl]but-1-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 90056627 |
| Molecular Formula | C24H28ClN3OS |
| Molecular Weight | 442.03 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-2-[6-(methylamino)-1-benzothiophen-3-yl]but-1-en-1-one;hydrochloride |
| SMILES | CNc1ccc2c(C(=C=O)CCN3CCN(Cc4ccccc4)CC3)csc2c1.Cl |
| InChI | InChI=1S/C24H27N3OS.ClH/c1-25-21-7-8-22-23(18-29-24(22)15-21)20(17-28)9-10-26-11-13-27(14-12-26)16-19-5-3-2-4-6-19;/h2-8,15,18,25H,9-14,16H2,1H3;1H |
| InChIKey | XFVCSADQMZIKJN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.03 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|