About 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide
2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide (PubChem CID 90063661) has the molecular formula C13H11F2N3O
and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide.
Molecular Properties
| Compound Name | 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide |
| PubChem CID | 90063661 |
| Molecular Formula | C13H11F2N3O |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide |
| SMILES | Nc1cccc(F)c1C(=O)NNc1cccc(F)c1 |
| InChI | InChI=1S/C13H11F2N3O/c14-8-3-1-4-9(7-8)17-18-13(19)12-10(15)5-2-6-11(12)16/h1-7,17H,16H2,(H,18,19) |
| InChIKey | DIBSIRRIPSAWJO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide?
The IUPAC name of 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide (CID 90063661) is 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide.
What is the SMILES notation for 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide?
The canonical SMILES for 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide is Nc1cccc(F)c1C(=O)NNc1cccc(F)c1.
What is the InChIKey of 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide?
The InChIKey is DIBSIRRIPSAWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2N3O/c14-8-3-1-4-9(7-8)17-18-13(19)12-10(15)5-2-6-11(12)16/h1-7,17H,16H2,(H,18,19).
What are the key properties of 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide?
2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide has a molecular weight of 263.25 g/mol, XLogP of 2.30, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-fluoro-N'-(3-fluorophenyl)benzohydrazide is sourced from PubChem (CID 90063661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).