C9H9F4N3O3 — CID 90074031
2-[3-(fluoromethyl)-2-nitropyrrol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 90074031) has the molecular formula C9H9F4N3O3 and a molecular weight of 283.18 g/mol. Its IUPAC name is 2-[3-(fluoromethyl)-2-nitropyrrol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[3-(fluoromethyl)-2-nitropyrrol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 90074031 |
| Molecular Formula | C9H9F4N3O3 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[3-(fluoromethyl)-2-nitropyrrol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cn1ccc(CF)c1[N+](=O)[O-])NCC(F)(F)F |
| InChI | InChI=1S/C9H9F4N3O3/c10-3-6-1-2-15(8(6)16(18)19)4-7(17)14-5-9(11,12)13/h1-2H,3-5H2,(H,14,17) |
| InChIKey | GVLGCAWJOBHZNM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|