About methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate
methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate (PubChem CID 90076408) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate |
| PubChem CID | 90076408 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate |
| SMILES | COC(=O)c1nscc1C(C)C |
| InChI | InChI=1S/C8H11NO2S/c1-5(2)6-4-12-9-7(6)8(10)11-3/h4-5H,1-3H3 |
| InChIKey | ABCVKJMBMJNCOH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate?
The IUPAC name of methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate (CID 90076408) is methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate.
What is the SMILES notation for methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate?
The canonical SMILES for methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate is COC(=O)c1nscc1C(C)C.
What is the InChIKey of methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate?
The InChIKey is ABCVKJMBMJNCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-5(2)6-4-12-9-7(6)8(10)11-3/h4-5H,1-3H3.
What are the key properties of methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate?
methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate has a molecular weight of 185.25 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-propan-2-yl-1,2-thiazole-3-carboxylate is sourced from PubChem (CID 90076408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).