C26H26FN5O3 — CID 90077805
(2S,3S,4R)-8-[[3-fluoro-6-(2-methyl-6-piperazin-1-yl-3-pyridinyl)-2-pyridinyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid (PubChem CID 90077805) has the molecular formula C26H26FN5O3 and a molecular weight of 475.52 g/mol. Its IUPAC name is (2S,3S,4R)-8-[[3-fluoro-6-(2-methyl-6-piperazin-1-yl-3-pyridinyl)-2-pyridinyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid.
| Compound Name | (2S,3S,4R)-8-[[3-fluoro-6-(2-methyl-6-piperazin-1-yl-3-pyridinyl)-2-pyridinyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 90077805 |
| Molecular Formula | C26H26FN5O3 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (2S,3S,4R)-8-[[3-fluoro-6-(2-methyl-6-piperazin-1-yl-3-pyridinyl)-2-pyridinyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
| SMILES | Cc1nc(N2CCNCC2)ccc1-c1ccc(F)c(COc2cc3c(cn2)[C@H]2[C@@H](C3)[C@@H]2C(=O)O)n1 |
| InChI | InChI=1S/C26H26FN5O3/c1-14-16(2-5-22(30-14)32-8-6-28-7-9-32)20-4-3-19(27)21(31-20)13-35-23-11-15-10-17-24(18(15)12-29-23)25(17)26(33)34/h2-5,11-12,17,24-25,28H,6-10,13H2,1H3,(H,33,34)/t17-,24-,25+/m1/s1 |
| InChIKey | LKTPNEUGLPSMMK-JHTITAFHSA-N |
| XLogP | 2.95 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |