C13H14N6 — CID 90079689
1-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaen-13-yl)pyrrolidin-3-amine (PubChem CID 90079689) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaen-13-yl)pyrrolidin-3-amine.
| Compound Name | 1-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaen-13-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90079689 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaen-13-yl)pyrrolidin-3-amine |
| SMILES | NC1CCN(c2cncc3nnc4[nH]ccc4c23)C1 |
| InChI | InChI=1S/C13H14N6/c14-8-2-4-19(7-8)11-6-15-5-10-12(11)9-1-3-16-13(9)18-17-10/h1,3,5-6,8H,2,4,7,14H2,(H,16,18) |
| InChIKey | ZWRQVNWCFZERLT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |