C31H41N5O5 — CID 90083345
[1-[[1-[6-amino-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]-methylcarbamic acid (PubChem CID 90083345) has the molecular formula C31H41N5O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is [1-[[1-[6-amino-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]-methylcarbamic acid.
| Compound Name | [1-[[1-[6-amino-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 90083345 |
| Molecular Formula | C31H41N5O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | [1-[[1-[6-amino-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]-methylcarbamic acid |
| SMILES | CC(C(=O)NC(C(=O)N1Cc2ccc(N)cc2CC1C(=O)N[C@@H]1CCCc2ccccc21)C(C)(C)C)N(C)C(=O)O |
| InChI | InChI=1S/C31H41N5O5/c1-18(35(5)30(40)41)27(37)34-26(31(2,3)4)29(39)36-17-20-13-14-22(32)15-21(20)16-25(36)28(38)33-24-12-8-10-19-9-6-7-11-23(19)24/h6-7,9,11,13-15,18,24-26H,8,10,12,16-17,32H2,1-5H3,(H,33,38)(H,34,37)(H,40,41)/t18?,24-,25?,26?/m1/s1 |
| InChIKey | RRIDXPFNWXTWBE-ROFYGORUSA-N |
| XLogP | 3.25 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|