C18H26O5 — CID 90083964
ethyl 6-oxo-8-[(1S,5R)-4-oxo-5-(3-oxopropyl)cyclopent-2-en-1-yl]octanoate (PubChem CID 90083964) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is ethyl 6-oxo-8-[(1S,5R)-4-oxo-5-(3-oxopropyl)cyclopent-2-en-1-yl]octanoate.
| Compound Name | ethyl 6-oxo-8-[(1S,5R)-4-oxo-5-(3-oxopropyl)cyclopent-2-en-1-yl]octanoate |
|---|---|
| PubChem CID | 90083964 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl 6-oxo-8-[(1S,5R)-4-oxo-5-(3-oxopropyl)cyclopent-2-en-1-yl]octanoate |
| SMILES | CCOC(=O)CCCCC(=O)CC[C@H]1C=CC(=O)[C@@H]1CCC=O |
| InChI | InChI=1S/C18H26O5/c1-2-23-18(22)8-4-3-6-15(20)11-9-14-10-12-17(21)16(14)7-5-13-19/h10,12-14,16H,2-9,11H2,1H3/t14-,16+/m0/s1 |
| InChIKey | SRNOHDRWAHAKFJ-GOEBONIOSA-N |
| XLogP | 2.81 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|