C10H13N3O2S3 — CID 900890
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] morpholine-4-carbodithioate (PubChem CID 900890) has the molecular formula C10H13N3O2S3 and a molecular weight of 303.43 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] morpholine-4-carbodithioate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 900890 |
| Molecular Formula | C10H13N3O2S3 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] morpholine-4-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCOCC1)Nc1nccs1 |
| InChI | InChI=1S/C10H13N3O2S3/c14-8(12-9-11-1-6-17-9)7-18-10(16)13-2-4-15-5-3-13/h1,6H,2-5,7H2,(H,11,12,14) |
| InChIKey | ALKYSMOUWSAQMC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|