C25H19N5O3 — CID 90106495
N-[4-[[2-amino-5-(furan-2-yl)phenyl]carbamoyl]phenyl]-1H-benzimidazole-2-carboxamide (PubChem CID 90106495) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[4-[[2-amino-5-(furan-2-yl)phenyl]carbamoyl]phenyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[4-[[2-amino-5-(furan-2-yl)phenyl]carbamoyl]phenyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 90106495 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[4-[[2-amino-5-(furan-2-yl)phenyl]carbamoyl]phenyl]-1H-benzimidazole-2-carboxamide |
| SMILES | Nc1ccc(-c2ccco2)cc1NC(=O)c1ccc(NC(=O)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H19N5O3/c26-18-12-9-16(22-6-3-13-33-22)14-21(18)30-24(31)15-7-10-17(11-8-15)27-25(32)23-28-19-4-1-2-5-20(19)29-23/h1-14H,26H2,(H,27,32)(H,28,29)(H,30,31) |
| InChIKey | BETWNJQSIICMIU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|