C21H33N3O2 — CID 90123180
N,N-diethyl-2-[(4-methoxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-ylidene)amino]oxyethanamine (PubChem CID 90123180) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N,N-diethyl-2-[(4-methoxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-ylidene)amino]oxyethanamine.
| Compound Name | N,N-diethyl-2-[(4-methoxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-ylidene)amino]oxyethanamine |
|---|---|
| PubChem CID | 90123180 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N,N-diethyl-2-[(4-methoxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-ylidene)amino]oxyethanamine |
| SMILES | CCN(CC)CCON=C1C2Cc3ccc(OC)cc3C1(C)CCN2C |
| InChI | InChI=1S/C21H33N3O2/c1-6-24(7-2)12-13-26-22-20-19-14-16-8-9-17(25-5)15-18(16)21(20,3)10-11-23(19)4/h8-9,15,19H,6-7,10-14H2,1-5H3 |
| InChIKey | LKBYYSFDFJGPLV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|