C36H35ClN2O5S — CID 90123607
2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-chlorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethyl hydrogen sulfite (PubChem CID 90123607) has the molecular formula C36H35ClN2O5S and a molecular weight of 643.21 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-chlorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethyl hydrogen sulfite.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-chlorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethyl hydrogen sulfite |
|---|---|
| PubChem CID | 90123607 |
| Molecular Formula | C36H35ClN2O5S |
| Molecular Weight | 643.21 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-chlorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethyl hydrogen sulfite |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCOS(=O)O)cc2)c2cc(-c3cccc(-c4ccc(Cl)cc4)c3)on2)cc1 |
| InChI | InChI=1S/C36H35ClN2O5S/c1-36(2,3)30-15-11-26(12-16-30)32(21-24-7-9-27(10-8-24)35(40)38-19-20-43-45(41)42)33-23-34(44-39-33)29-6-4-5-28(22-29)25-13-17-31(37)18-14-25/h4-18,22-23,32H,19-21H2,1-3H3,(H,38,40)(H,41,42) |
| InChIKey | LXHLZAFTUBREHV-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.21 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|