C27H41N5O2 — CID 90130916
3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-5-hydroxy-2-methylpentanehydrazide (PubChem CID 90130916) has the molecular formula C27H41N5O2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-5-hydroxy-2-methylpentanehydrazide.
| Compound Name | 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-5-hydroxy-2-methylpentanehydrazide |
|---|---|
| PubChem CID | 90130916 |
| Molecular Formula | C27H41N5O2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-5-hydroxy-2-methylpentanehydrazide |
| SMILES | Cc1ccc(N(N)C(=O)C(C)C(CCO)c2nnc(C3CC(CC(C)C)C3)n2C2CC2)c(C)c1 |
| InChI | InChI=1S/C27H41N5O2/c1-16(2)12-20-14-21(15-20)25-29-30-26(31(25)22-7-8-22)23(10-11-33)19(5)27(34)32(28)24-9-6-17(3)13-18(24)4/h6,9,13,16,19-23,33H,7-8,10-12,14-15,28H2,1-5H3 |
| InChIKey | DQRIJLSETWVDCZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|