C27H55N3O10 — CID 90136236
4-[3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[6-[[4-(3-hydroperoxypropyl)-7-hydroxy-4-methylheptoxy]amino]hexyl]butanamide (PubChem CID 90136236) has the molecular formula C27H55N3O10 and a molecular weight of 581.75 g/mol. Its IUPAC name is 4-[3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[6-[[4-(3-hydroperoxypropyl)-7-hydroxy-4-methylheptoxy]amino]hexyl]butanamide.
| Compound Name | 4-[3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[6-[[4-(3-hydroperoxypropyl)-7-hydroxy-4-methylheptoxy]amino]hexyl]butanamide |
|---|---|
| PubChem CID | 90136236 |
| Molecular Formula | C27H55N3O10 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | 4-[3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[6-[[4-(3-hydroperoxypropyl)-7-hydroxy-4-methylheptoxy]amino]hexyl]butanamide |
| SMILES | CC(CCCO)(CCCOO)CCCONCCCCCCNC(=O)CCCOC1OC(CO)C(O)C(O)C1N |
| InChI | InChI=1S/C27H55N3O10/c1-27(11-7-16-31,13-9-19-39-36)12-8-18-38-30-15-5-3-2-4-14-29-22(33)10-6-17-37-26-23(28)25(35)24(34)21(20-32)40-26/h21,23-26,30-32,34-36H,2-20,28H2,1H3,(H,29,33) |
| InChIKey | CCMOLVQYRDSTHD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 205.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|