C15H12ClF3N2O4 — CID 90144801
4-[4-chloro-3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-3-ethoxycarbonylbenzoic acid (PubChem CID 90144801) has the molecular formula C15H12ClF3N2O4 and a molecular weight of 376.72 g/mol. Its IUPAC name is 4-[4-chloro-3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-3-ethoxycarbonylbenzoic acid.
| Compound Name | 4-[4-chloro-3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-3-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 90144801 |
| Molecular Formula | C15H12ClF3N2O4 |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 4-[4-chloro-3-methyl-5-(trifluoromethyl)pyrazol-1-yl]-3-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1cc(C(=O)O)ccc1-n1nc(C)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C15H12ClF3N2O4/c1-3-25-14(24)9-6-8(13(22)23)4-5-10(9)21-12(15(17,18)19)11(16)7(2)20-21/h4-6H,3H2,1-2H3,(H,22,23) |
| InChIKey | GRYJOEDCIYNTAL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |