C28H32N4O7S2 — CID 90154644
2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-[3-[4-(methylsulfonylcarbamoyl)phenyl]piperidine-1-carbonyl]benzamide (PubChem CID 90154644) has the molecular formula C28H32N4O7S2 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-[3-[4-(methylsulfonylcarbamoyl)phenyl]piperidine-1-carbonyl]benzamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-[3-[4-(methylsulfonylcarbamoyl)phenyl]piperidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 90154644 |
| Molecular Formula | C28H32N4O7S2 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-[3-[4-(methylsulfonylcarbamoyl)phenyl]piperidine-1-carbonyl]benzamide |
| SMILES | Cc1ccc(C)n1-c1cc(C(=O)N2CCCC(c3ccc(C(=O)NS(C)(=O)=O)cc3)C2)ccc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C28H32N4O7S2/c1-18-7-8-19(2)32(18)25-16-22(13-14-24(25)27(34)30-41(4,38)39)28(35)31-15-5-6-23(17-31)20-9-11-21(12-10-20)26(33)29-40(3,36)37/h7-14,16,23H,5-6,15,17H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | DQJWWSVROPCQKF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|