C26H29N3O4S — CID 118443974
2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-(3-phenylpiperidine-1-carbonyl)benzamide (PubChem CID 118443974) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-(3-phenylpiperidine-1-carbonyl)benzamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-(3-phenylpiperidine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 118443974 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-N-methylsulfonyl-4-(3-phenylpiperidine-1-carbonyl)benzamide |
| SMILES | Cc1ccc(C)n1-c1cc(C(=O)N2CCCC(c3ccccc3)C2)ccc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C26H29N3O4S/c1-18-11-12-19(2)29(18)24-16-21(13-14-23(24)25(30)27-34(3,32)33)26(31)28-15-7-10-22(17-28)20-8-5-4-6-9-20/h4-6,8-9,11-14,16,22H,7,10,15,17H2,1-3H3,(H,27,30) |
| InChIKey | LQBJVIVZNUBRCH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|