C26H28N2O4 — CID 144620713
2-(2-ethyl-5-methylpyrrol-1-yl)-4-[3-(2-hydroxyphenyl)piperidine-1-carbonyl]benzoic acid (PubChem CID 144620713) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-(2-ethyl-5-methylpyrrol-1-yl)-4-[3-(2-hydroxyphenyl)piperidine-1-carbonyl]benzoic acid.
| Compound Name | 2-(2-ethyl-5-methylpyrrol-1-yl)-4-[3-(2-hydroxyphenyl)piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 144620713 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-(2-ethyl-5-methylpyrrol-1-yl)-4-[3-(2-hydroxyphenyl)piperidine-1-carbonyl]benzoic acid |
| SMILES | CCc1ccc(C)n1-c1cc(C(=O)N2CCCC(c3ccccc3O)C2)ccc1C(=O)O |
| InChI | InChI=1S/C26H28N2O4/c1-3-20-12-10-17(2)28(20)23-15-18(11-13-22(23)26(31)32)25(30)27-14-6-7-19(16-27)21-8-4-5-9-24(21)29/h4-5,8-13,15,19,29H,3,6-7,14,16H2,1-2H3,(H,31,32) |
| InChIKey | OJFKZBKCNHESAE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|