C16H13N5 — CID 90157706
N-imino-N',3-diphenylpyrazole-1-carboximidamide (PubChem CID 90157706) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-imino-N',3-diphenylpyrazole-1-carboximidamide.
| Compound Name | N-imino-N',3-diphenylpyrazole-1-carboximidamide |
|---|---|
| PubChem CID | 90157706 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-imino-N',3-diphenylpyrazole-1-carboximidamide |
| SMILES | [H]/N=N/C(=N\c1ccccc1)n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13N5/c17-19-16(18-14-9-5-2-6-10-14)21-12-11-15(20-21)13-7-3-1-4-8-13/h1-12,17H/b18-16+,19-17+ |
| InChIKey | JBMFRARLQHXKPO-YWNVXTCZSA-N |
| XLogP | 4.12 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|