C24H24N2O5 — CID 9015774
[2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 9015774) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 9015774 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | COc1ccc2cc(CN(C)C(=O)COC(=O)c3ccc(NC(C)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C24H24N2O5/c1-16(27)25-21-9-6-18(7-10-21)24(29)31-15-23(28)26(2)14-17-4-5-20-13-22(30-3)11-8-19(20)12-17/h4-13H,14-15H2,1-3H3,(H,25,27) |
| InChIKey | VIMJZTPGMKALPB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |