C20H21N3O4S — CID 90158600
[5-(4-cyanophenyl)-2-(4-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-3-yl]methyl methanesulfonate (PubChem CID 90158600) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is [5-(4-cyanophenyl)-2-(4-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-3-yl]methyl methanesulfonate.
| Compound Name | [5-(4-cyanophenyl)-2-(4-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90158600 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [5-(4-cyanophenyl)-2-(4-methoxyphenyl)-4-methyl-3,4-dihydropyrazol-3-yl]methyl methanesulfonate |
| SMILES | COc1ccc(N2N=C(c3ccc(C#N)cc3)C(C)C2COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-14-19(13-27-28(3,24)25)23(17-8-10-18(26-2)11-9-17)22-20(14)16-6-4-15(12-21)5-7-16/h4-11,14,19H,13H2,1-3H3 |
| InChIKey | YPVJXKUZJNKANH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|