C19H27N5O12 — CID 90159484
(2S)-3-phenyl-2-[[(2R,3R,4R,5R)-2,3,4,5-tetracarbamoyloxy-6-hydroxyhexoxy]amino]propanoic acid (PubChem CID 90159484) has the molecular formula C19H27N5O12 and a molecular weight of 517.45 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[(2R,3R,4R,5R)-2,3,4,5-tetracarbamoyloxy-6-hydroxyhexoxy]amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[(2R,3R,4R,5R)-2,3,4,5-tetracarbamoyloxy-6-hydroxyhexoxy]amino]propanoic acid |
|---|---|
| PubChem CID | 90159484 |
| Molecular Formula | C19H27N5O12 |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (2S)-3-phenyl-2-[[(2R,3R,4R,5R)-2,3,4,5-tetracarbamoyloxy-6-hydroxyhexoxy]amino]propanoic acid |
| SMILES | NC(=O)O[C@@H]([C@H](OC(N)=O)[C@@H](CON[C@@H](Cc1ccccc1)C(=O)O)OC(N)=O)[C@@H](CO)OC(N)=O |
| InChI | InChI=1S/C19H27N5O12/c20-16(28)33-11(7-25)13(35-18(22)30)14(36-19(23)31)12(34-17(21)29)8-32-24-10(15(26)27)6-9-4-2-1-3-5-9/h1-5,10-14,24-25H,6-8H2,(H2,20,28)(H2,21,29)(H2,22,30)(H2,23,31)(H,26,27)/t10-,11+,12+,13+,14+/m0/s1 |
| InChIKey | MOISEEHOCQYDRG-RYMFRWLXSA-N |
| XLogP | -1.95 |
| TPSA | 288.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|