C23H33N5O2 — CID 90163606
N-methyl-N-[7-(methylamino)-7-oxoheptyl]-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide (PubChem CID 90163606) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-methyl-N-[7-(methylamino)-7-oxoheptyl]-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide.
| Compound Name | N-methyl-N-[7-(methylamino)-7-oxoheptyl]-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90163606 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-methyl-N-[7-(methylamino)-7-oxoheptyl]-2-(2,4,6-trimethylanilino)pyrimidine-5-carboxamide |
| SMILES | CNC(=O)CCCCCCN(C)C(=O)c1cnc(Nc2c(C)cc(C)cc2C)nc1 |
| InChI | InChI=1S/C23H33N5O2/c1-16-12-17(2)21(18(3)13-16)27-23-25-14-19(15-26-23)22(30)28(5)11-9-7-6-8-10-20(29)24-4/h12-15H,6-11H2,1-5H3,(H,24,29)(H,25,26,27) |
| InChIKey | BDFFMSJARUHPLO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|