About CID 90172809
CID 90172809 (PubChem CID 90172809) has the molecular formula C14H20F2O3Si
and a molecular weight of 302.39 g/mol.
Molecular Properties
| Compound Name | CID 90172809 |
| PubChem CID | 90172809 |
| Molecular Formula | C14H20F2O3Si |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | — |
| SMILES | CC(C)OC(O[Si]Cc1ccc(F)c(F)c1)OC(C)C |
| InChI | InChI=1S/C14H20F2O3Si/c1-9(2)17-14(18-10(3)4)19-20-8-11-5-6-12(15)13(16)7-11/h5-7,9-10,14H,8H2,1-4H3 |
| InChIKey | VRJAGQVYWQJARC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 90172809 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90172809?
The IUPAC name of CID 90172809 (CID 90172809) is not available.
What is the SMILES notation for CID 90172809?
The canonical SMILES for CID 90172809 is CC(C)OC(O[Si]Cc1ccc(F)c(F)c1)OC(C)C.
What is the InChIKey of CID 90172809?
The InChIKey is VRJAGQVYWQJARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2O3Si/c1-9(2)17-14(18-10(3)4)19-20-8-11-5-6-12(15)13(16)7-11/h5-7,9-10,14H,8H2,1-4H3.
What are the key properties of CID 90172809?
CID 90172809 has a molecular weight of 302.39 g/mol, XLogP of 3.23, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90172809 is sourced from PubChem (CID 90172809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).