C24H28N2O3 — CID 9017699
[2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 9017699) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 9017699 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | [2-[[(1S)-1-(4-ethylphenyl)-2-methylpropyl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CCc1ccc([C@@H](NC(=O)COC(=O)Cc2c[nH]c3ccccc23)C(C)C)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-4-17-9-11-18(12-10-17)24(16(2)3)26-22(27)15-29-23(28)13-19-14-25-21-8-6-5-7-20(19)21/h5-12,14,16,24-25H,4,13,15H2,1-3H3,(H,26,27)/t24-/m0/s1 |
| InChIKey | CUXRTWUGOGFYFU-DEOSSOPVSA-N |
| XLogP | 4.33 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |