C21H23NO8 — CID 90182708
2-(3-methylpentan-3-yl)-1,3-dioxo-6-(2-prop-2-enoyloxyethoxycarbonyl)isoindole-5-carboxylic acid (PubChem CID 90182708) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-(3-methylpentan-3-yl)-1,3-dioxo-6-(2-prop-2-enoyloxyethoxycarbonyl)isoindole-5-carboxylic acid.
| Compound Name | 2-(3-methylpentan-3-yl)-1,3-dioxo-6-(2-prop-2-enoyloxyethoxycarbonyl)isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 90182708 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(3-methylpentan-3-yl)-1,3-dioxo-6-(2-prop-2-enoyloxyethoxycarbonyl)isoindole-5-carboxylic acid |
| SMILES | C=CC(=O)OCCOC(=O)c1cc2c(cc1C(=O)O)C(=O)N(C(C)(CC)CC)C2=O |
| InChI | InChI=1S/C21H23NO8/c1-5-16(23)29-8-9-30-20(28)15-11-13-12(10-14(15)19(26)27)17(24)22(18(13)25)21(4,6-2)7-3/h5,10-11H,1,6-9H2,2-4H3,(H,26,27) |
| InChIKey | KRBZUCHOXDECTJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|