C7H14FNO — CID 90183687
(3R,4S)-3-fluoro-4-methoxy-4-methylpiperidine (PubChem CID 90183687) has the molecular formula C7H14FNO and a molecular weight of 147.19 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-4-methoxy-4-methylpiperidine.
| Compound Name | (3R,4S)-3-fluoro-4-methoxy-4-methylpiperidine |
|---|---|
| PubChem CID | 90183687 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | (3R,4S)-3-fluoro-4-methoxy-4-methylpiperidine |
| SMILES | CO[C@@]1(C)CCNC[C@H]1F |
| InChI | InChI=1S/C7H14FNO/c1-7(10-2)3-4-9-5-6(7)8/h6,9H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | FVRGVIPTFHQWRD-RQJHMYQMSA-N |
| XLogP | 0.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |