C16H17BrFN3O4S — CID 90190067
N-[(2S)-2-amino-2-(3-bromo-4-fluorophenyl)ethyl]-N-ethyl-4-nitrobenzenesulfonamide (PubChem CID 90190067) has the molecular formula C16H17BrFN3O4S and a molecular weight of 446.30 g/mol. Its IUPAC name is N-[(2S)-2-amino-2-(3-bromo-4-fluorophenyl)ethyl]-N-ethyl-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-2-amino-2-(3-bromo-4-fluorophenyl)ethyl]-N-ethyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90190067 |
| Molecular Formula | C16H17BrFN3O4S |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | N-[(2S)-2-amino-2-(3-bromo-4-fluorophenyl)ethyl]-N-ethyl-4-nitrobenzenesulfonamide |
| SMILES | CCN(C[C@@H](N)c1ccc(F)c(Br)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17BrFN3O4S/c1-2-20(10-16(19)11-3-8-15(18)14(17)9-11)26(24,25)13-6-4-12(5-7-13)21(22)23/h3-9,16H,2,10,19H2,1H3/t16-/m1/s1 |
| InChIKey | LEBWFGCJXVCHDT-MRXNPFEDSA-N |
| XLogP | 3.21 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|