C17H17F4N3O4S — CID 90190285
N-[(2R)-2-amino-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide (PubChem CID 90190285) has the molecular formula C17H17F4N3O4S and a molecular weight of 435.40 g/mol. Its IUPAC name is N-[(2R)-2-amino-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-2-amino-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90190285 |
| Molecular Formula | C17H17F4N3O4S |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[(2R)-2-amino-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide |
| SMILES | CCN(C[C@H](N)c1cc(F)cc(C(F)(F)F)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17F4N3O4S/c1-2-23(29(27,28)15-5-3-14(4-6-15)24(25)26)10-16(22)11-7-12(17(19,20)21)9-13(18)8-11/h3-9,16H,2,10,22H2,1H3/t16-/m0/s1 |
| InChIKey | RHLCRAKWPPRUTF-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|