C18H18ClF6N3O4S — CID 90189929
N-[(2S)-2-amino-2-[3,4-bis(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 90189929) has the molecular formula C18H18ClF6N3O4S and a molecular weight of 521.87 g/mol. Its IUPAC name is N-[(2S)-2-amino-2-[3,4-bis(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[(2S)-2-amino-2-[3,4-bis(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 90189929 |
| Molecular Formula | C18H18ClF6N3O4S |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | N-[(2S)-2-amino-2-[3,4-bis(trifluoromethyl)phenyl]ethyl]-N-ethyl-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CCN(C[C@@H](N)c1ccc(C(F)(F)F)c(C(F)(F)F)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C18H17F6N3O4S.ClH/c1-2-26(32(30,31)13-6-4-12(5-7-13)27(28)29)10-16(25)11-3-8-14(17(19,20)21)15(9-11)18(22,23)24;/h3-9,16H,2,10,25H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | YQIGHRXOBHSQJZ-PKLMIRHRSA-N |
| XLogP | 4.76 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|