C16H15ClF3N3O5S — CID 66714340
N-[2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide (PubChem CID 66714340) has the molecular formula C16H15ClF3N3O5S and a molecular weight of 453.83 g/mol. Its IUPAC name is N-[2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66714340 |
| Molecular Formula | C16H15ClF3N3O5S |
| Molecular Weight | 453.83 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | N-[2-amino-2-[3-chloro-4-(trifluoromethoxy)phenyl]ethyl]-N-methyl-4-nitrobenzenesulfonamide |
| SMILES | CN(CC(N)c1ccc(OC(F)(F)F)c(Cl)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15ClF3N3O5S/c1-22(29(26,27)12-5-3-11(4-6-12)23(24)25)9-14(21)10-2-7-15(13(17)8-10)28-16(18,19)20/h2-8,14H,9,21H2,1H3 |
| InChIKey | ALAZWGZRERZNEY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|