C18H20ClF4N3O4S — CID 90190489
N-[(2S)-2-amino-2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-N-propan-2-ylbenzenesulfonamide;hydrochloride (PubChem CID 90190489) has the molecular formula C18H20ClF4N3O4S and a molecular weight of 485.89 g/mol. Its IUPAC name is N-[(2S)-2-amino-2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-N-propan-2-ylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[(2S)-2-amino-2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-N-propan-2-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 90190489 |
| Molecular Formula | C18H20ClF4N3O4S |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-[(2S)-2-amino-2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-N-propan-2-ylbenzenesulfonamide;hydrochloride |
| SMILES | CC(C)N(C[C@@H](N)c1ccc(F)c(C(F)(F)F)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C18H19F4N3O4S.ClH/c1-11(2)24(30(28,29)14-6-4-13(5-7-14)25(26)27)10-17(23)12-3-8-16(19)15(9-12)18(20,21)22;/h3-9,11,17H,10,23H2,1-2H3;1H/t17-;/m1./s1 |
| InChIKey | RHLXPNQHLNJFIO-UNTBIKODSA-N |
| XLogP | 4.27 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|