C18H31I — CID 90206723
(5S)-3-(1-ethyl-3-iodo-3-methylcyclohexyl)-1,2,2-trimethylbicyclo[3.1.0]hexane (PubChem CID 90206723) has the molecular formula C18H31I and a molecular weight of 374.35 g/mol. Its IUPAC name is (5S)-3-(1-ethyl-3-iodo-3-methylcyclohexyl)-1,2,2-trimethylbicyclo[3.1.0]hexane.
| Compound Name | (5S)-3-(1-ethyl-3-iodo-3-methylcyclohexyl)-1,2,2-trimethylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 90206723 |
| Molecular Formula | C18H31I |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (5S)-3-(1-ethyl-3-iodo-3-methylcyclohexyl)-1,2,2-trimethylbicyclo[3.1.0]hexane |
| SMILES | CCC1(C2C[C@H]3CC3(C)C2(C)C)CCCC(C)(I)C1 |
| InChI | InChI=1S/C18H31I/c1-6-18(9-7-8-16(4,19)12-18)14-10-13-11-17(13,5)15(14,2)3/h13-14H,6-12H2,1-5H3/t13-,14?,16?,17?,18?/m0/s1 |
| InChIKey | RKVOFSYNMGMPFB-RIHKDHQYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|