C46H88N2O8 — CID 90207635
decyl 3-[(3-decoxy-3-oxopropyl)-[2-[(3-decoxy-3-oxopropyl)-(3-methoxy-3-oxopropyl)amino]propyl]amino]propanoate (PubChem CID 90207635) has the molecular formula C46H88N2O8 and a molecular weight of 797.22 g/mol. Its IUPAC name is decyl 3-[(3-decoxy-3-oxopropyl)-[2-[(3-decoxy-3-oxopropyl)-(3-methoxy-3-oxopropyl)amino]propyl]amino]propanoate.
| Compound Name | decyl 3-[(3-decoxy-3-oxopropyl)-[2-[(3-decoxy-3-oxopropyl)-(3-methoxy-3-oxopropyl)amino]propyl]amino]propanoate |
|---|---|
| PubChem CID | 90207635 |
| Molecular Formula | C46H88N2O8 |
| Molecular Weight | 797.22 g/mol |
| Exact Mass | 796.65 |
| IUPAC Name | decyl 3-[(3-decoxy-3-oxopropyl)-[2-[(3-decoxy-3-oxopropyl)-(3-methoxy-3-oxopropyl)amino]propyl]amino]propanoate |
| SMILES | CCCCCCCCCCOC(=O)CCN(CCC(=O)OCCCCCCCCCC)CC(C)N(CCC(=O)OC)CCC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C46H88N2O8/c1-6-9-12-15-18-21-24-27-38-54-44(50)30-34-47(35-31-45(51)55-39-28-25-22-19-16-13-10-7-2)41-42(4)48(36-32-43(49)53-5)37-33-46(52)56-40-29-26-23-20-17-14-11-8-3/h42H,6-41H2,1-5H3 |
| InChIKey | HXGGULOMXCGLOV-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.22 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|