C22H29F2N2O4PS — CID 90218418
3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 90218418) has the molecular formula C22H29F2N2O4PS and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218418 |
| Molecular Formula | C22H29F2N2O4PS |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCC2(c3ccccc3F)COC2)cn1 |
| InChI | InChI=1S/C22H29F2N2O4PS/c23-19-7-2-1-6-18(19)22(15-30-16-22)8-3-4-11-32-21-14-26-17(12-20(21)24)13-25-9-5-10-31(27,28)29/h1-2,6-7,12,14,25H,3-5,8-11,13,15-16H2,(H2,27,28,29) |
| InChIKey | LTQJNIXCQDYZOU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|