C24H34FN2O3PS — CID 90218587
3-[[4-fluoro-5-[4-(1-phenylcyclopentyl)butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 90218587) has the molecular formula C24H34FN2O3PS and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[4-(1-phenylcyclopentyl)butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-fluoro-5-[4-(1-phenylcyclopentyl)butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218587 |
| Molecular Formula | C24H34FN2O3PS |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[[4-fluoro-5-[4-(1-phenylcyclopentyl)butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCC2(c3ccccc3)CCCC2)cn1 |
| InChI | InChI=1S/C24H34FN2O3PS/c25-22-17-21(18-26-14-8-15-31(28,29)30)27-19-23(22)32-16-7-6-13-24(11-4-5-12-24)20-9-2-1-3-10-20/h1-3,9-10,17,19,26H,4-8,11-16,18H2,(H2,28,29,30) |
| InChIKey | QVIJUYPOZVIGRZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|