C44H58F4N4O3PS2+ — CID 90218450
bis[3-[[4-fluoro-5-[5-(4-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propoxy]-oxophosphanium (PubChem CID 90218450) has the molecular formula C44H58F4N4O3PS2+ and a molecular weight of 862.07 g/mol. Its IUPAC name is bis[3-[[4-fluoro-5-[5-(4-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propoxy]-oxophosphanium.
| Compound Name | bis[3-[[4-fluoro-5-[5-(4-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 90218450 |
| Molecular Formula | C44H58F4N4O3PS2+ |
| Molecular Weight | 862.07 g/mol |
| Exact Mass | 861.36 |
| IUPAC Name | bis[3-[[4-fluoro-5-[5-(4-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propoxy]-oxophosphanium |
| SMILES | CC(C)(CCCCSc1cnc(CNCCCO[P+](=O)OCCCNCc2cc(F)c(SCCCCC(C)(C)c3ccc(F)cc3)cn2)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C44H58F4N4O3PS2/c1-43(2,33-11-15-35(45)16-12-33)19-5-7-25-57-41-31-51-37(27-39(41)47)29-49-21-9-23-54-56(53)55-24-10-22-50-30-38-28-40(48)42(32-52-38)58-26-8-6-20-44(3,4)34-13-17-36(46)18-14-34/h11-18,27-28,31-32,49-50H,5-10,19-26,29-30H2,1-4H3/q+1 |
| InChIKey | ASESDEGHBBNNHT-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.07 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|