C22H31F2N2O3PS — CID 90218469
3-[[4-fluoro-5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 90218469) has the molecular formula C22H31F2N2O3PS and a molecular weight of 472.54 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-fluoro-5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218469 |
| Molecular Formula | C22H31F2N2O3PS |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-[[4-fluoro-5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | CC(C)(CCCCSc1cnc(CNCCCP(=O)(O)O)cc1F)c1ccccc1F |
| InChI | InChI=1S/C22H31F2N2O3PS/c1-22(2,18-8-3-4-9-19(18)23)10-5-6-13-31-21-16-26-17(14-20(21)24)15-25-11-7-12-30(27,28)29/h3-4,8-9,14,16,25H,5-7,10-13,15H2,1-2H3,(H2,27,28,29) |
| InChIKey | ZZNHCGPUXWMOBL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|